| Name |
(S)-3,6-Di-tert-butyl 2-methyl 4-(benzyloxy)-8-(chloromethyl)-7,8-dihydropyrrolo[3,2-e]indole-2,3,6-tricarboxylate
|
| Molecular Formula |
C30H35ClN2O7
|
| Molecular Weight |
571.1
|
| Smiles |
COC(=O)c1cc2c3c(cc(OCc4ccccc4)c2n1C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)CC3CCl
|
COC(=O)c1cc2c3c(cc(OCc4ccccc4)c2n1C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)CC3CCl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.