| Name |
Acetic acid, 2,2,2-trifluoro-, (1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester
|
| Molecular Formula |
C11H6F3NO4
|
| Molecular Weight |
273.16
|
| Smiles |
O=C1c2ccccc2C(=O)N1COC(=O)C(F)(F)F
|
O=C1c2ccccc2C(=O)N1COC(=O)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.