| Name |
2-(8-(isobutylamino)-1,3-dimethyl-2,6-dioxo-2,3-dihydro-1H-purin-7(6H)-yl)acetic acid
|
| Molecular Formula |
C13H19N5O4
|
| Molecular Weight |
309.32
|
| Smiles |
CC(C)CNc1nc2c(c(=O)n(C)c(=O)n2C)n1CC(=O)O
|
CC(C)CNc1nc2c(c(=O)n(C)c(=O)n2C)n1CC(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.