| Name |
8-(2-((3-chloro-2-methylphenyl)amino)ethyl)-1,6,7-trimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione
|
| Molecular Formula |
C19H21ClN6O2
|
| Molecular Weight |
400.9
|
| Smiles |
Cc1c(Cl)cccc1NCCn1c(C)c(C)n2c3c(=O)[nH]c(=O)n(C)c3nc12
|
Cc1c(Cl)cccc1NCCn1c(C)c(C)n2c3c(=O)[nH]c(=O)n(C)c3nc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.