| Name |
3-((2E)but-2-enyl)-8-(2,4-dimethylphenyl)-1-methyl-1,3,5-trihydroimidazolidino [1,2-h]purine-2,4-dione
|
| Molecular Formula |
C20H23N5O2
|
| Molecular Weight |
365.4
|
| Smiles |
CC=CCn1c(=O)c2c(nc3n2CCN3c2ccc(C)cc2C)n(C)c1=O
|
CC=CCn1c(=O)c2c(nc3n2CCN3c2ccc(C)cc2C)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.