| Name |
6-(((4-methylpyrimidin-2-yl)thio)methyl)-4-oxo-4H-pyran-3-yl 2,5-dichlorobenzoate
|
| Molecular Formula |
C18H12Cl2N2O4S
|
| Molecular Weight |
423.3
|
| Smiles |
Cc1ccnc(SCc2cc(=O)c(OC(=O)c3cc(Cl)ccc3Cl)co2)n1
|
Cc1ccnc(SCc2cc(=O)c(OC(=O)c3cc(Cl)ccc3Cl)co2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.