| Name |
1h-Pyrrolo[2,3-c]pyridine-5-carboxamide,1-[(2,4-difluorophenyl)methyl]-n-hydroxy-3-[(2-methoxyethoxy)methyl]-n-methyl-
|
| Molecular Formula |
C20H21F2N3O4
|
| Molecular Weight |
405.4
|
| Smiles |
COCCOCc1cn(Cc2ccc(F)cc2F)c2cnc(C(=O)N(C)O)cc12
|
COCCOCc1cn(Cc2ccc(F)cc2F)c2cnc(C(=O)N(C)O)cc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.