| Name |
2,2'-(4-Chloro-6-nitro-1,3-phenylene)diacetic acid
|
| Molecular Formula |
C10H8ClNO6
|
| Molecular Weight |
273.62
|
| Smiles |
O=C(O)Cc1cc(CC(=O)O)c([N+](=O)[O-])cc1Cl
|
O=C(O)Cc1cc(CC(=O)O)c([N+](=O)[O-])cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.