| Name |
Ethyl 2-{5-[(4-fluorophenyl)amino]-2,4-dioxo-1,3-thiazolidin-3-yl}acetate
|
| Molecular Formula |
C13H13FN2O4S
|
| Molecular Weight |
312.32
|
| Smiles |
CCOC(=O)CN1C(=O)SC(Nc2ccc(F)cc2)C1=O
|
CCOC(=O)CN1C(=O)SC(Nc2ccc(F)cc2)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.