| Name |
[(1E)-1-[(8S,9S,10R,11S,13S,14S)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]-2-oxoethyl] acetate
|
| Molecular Formula |
C23H28O5
|
| Molecular Weight |
384.5
|
| Smiles |
CC(=O)OC(C=O)=C1CCC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC12C
|
CC(=O)OC(C=O)=C1CCC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC12C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.