| Name |
(2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline
|
| Molecular Formula |
C17H13ClN2
|
| Molecular Weight |
280.7
|
| Smiles |
Clc1ccc2c(c1)C=CC1=NC(c3ccccc3)CN12
|
Clc1ccc2c(c1)C=CC1=NC(c3ccccc3)CN12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.