| Name |
Methyl 4-[(6-chloro-1,3-benzothiazol-2-YL)[2-(dimethylamino)ethyl]carbamoyl]benzoate hydrochloride
|
| Molecular Formula |
C20H21Cl2N3O3S
|
| Molecular Weight |
454.4
|
| Smiles |
COC(=O)c1ccc(C(=O)N(CCN(C)C)c2nc3ccc(Cl)cc3s2)cc1.Cl
|
COC(=O)c1ccc(C(=O)N(CCN(C)C)c2nc3ccc(Cl)cc3s2)cc1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.