| Name |
4-Hexenoic acid, 4-(trimethylsilyl)-, ethyl ester, (E)-
|
| Molecular Formula |
C11H22O2Si
|
| Molecular Weight |
214.38
|
| Smiles |
CC=C(CCC(=O)OCC)[Si](C)(C)C
|
CC=C(CCC(=O)OCC)[Si](C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.