| Name |
1-(2,4-Dichlorophenyl)-3,3,3-trifluoro-1-propanone
|
| Molecular Formula |
C9H5Cl2F3O
|
| Molecular Weight |
257.03
|
| Smiles |
O=C(CC(F)(F)F)c1ccc(Cl)cc1Cl
|
O=C(CC(F)(F)F)c1ccc(Cl)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.