| Name |
3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H,4H,7H,8H-imidazo[4,5-d][1,3]diazepin-8-ol
|
| Molecular Formula |
C11H16N4O4
|
| Molecular Weight |
268.27
|
| Smiles |
OCC1OC(n2cnc3c2NC=NCC3O)CC1O
|
OCC1OC(n2cnc3c2NC=NCC3O)CC1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.