| Name |
N-(2,5-difluorophenyl)-2-((1,1-dioxido-4H-benzo[e][1,2,4]thiadiazin-3-yl)thio)acetamide
|
| Molecular Formula |
C15H11F2N3O3S2
|
| Molecular Weight |
383.4
|
| Smiles |
O=C(CSC1=NS(=O)(=O)c2ccccc2N1)Nc1cc(F)ccc1F
|
O=C(CSC1=NS(=O)(=O)c2ccccc2N1)Nc1cc(F)ccc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.