| Name |
7-Chloro-5-(1,4-dioxa-8-azaspiro[4.5]dec-8-yl)-3-(3-fluorophenyl)[1,2,3]triazolo[1,5-a]quinazoline
|
| Molecular Formula |
C22H19ClFN5O2
|
| Molecular Weight |
439.9
|
| Smiles |
Fc1cccc(-c2nnn3c2nc(N2CCC4(CC2)OCCO4)c2cc(Cl)ccc23)c1
|
Fc1cccc(-c2nnn3c2nc(N2CCC4(CC2)OCCO4)c2cc(Cl)ccc23)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.