| Name |
2-{[5-benzyl-4-(1H-pyrrol-1-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-[2-(trifluoromethyl)phenyl]acetamide
|
| Molecular Formula |
C22H18F3N5OS
|
| Molecular Weight |
457.5
|
| Smiles |
O=C(CSc1nnc(Cc2ccccc2)n1-n1cccc1)Nc1ccccc1C(F)(F)F
|
O=C(CSc1nnc(Cc2ccccc2)n1-n1cccc1)Nc1ccccc1C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.