| Name |
N-(2-ethylphenyl)-2-{[5-(2-methoxyphenyl)-4-(1H-pyrrol-1-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide
|
| Molecular Formula |
C23H23N5O2S
|
| Molecular Weight |
433.5
|
| Smiles |
CCc1ccccc1NC(=O)CSc1nnc(-c2ccccc2OC)n1-n1cccc1
|
CCc1ccccc1NC(=O)CSc1nnc(-c2ccccc2OC)n1-n1cccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.