| Name |
ethyl 2-[({[5-(3-methoxyphenyl)-4-(1H-pyrrol-1-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetyl)amino]benzoate
|
| Molecular Formula |
C24H23N5O4S
|
| Molecular Weight |
477.5
|
| Smiles |
CCOC(=O)c1ccccc1NC(=O)CSc1nnc(-c2cccc(OC)c2)n1-n1cccc1
|
CCOC(=O)c1ccccc1NC(=O)CSc1nnc(-c2cccc(OC)c2)n1-n1cccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.