| Name |
3-(4-chlorophenyl)-3-hydroxy-1-(m-tolyl)-3,5,6,7-tetrahydro-2H-imidazo[2,1-b][1,3]thiazin-1-ium bromide
|
| Molecular Formula |
C19H20BrClN2OS
|
| Molecular Weight |
439.8
|
| Smiles |
Cc1cccc(N2CC(O)(c3ccc(Cl)cc3)[N+]3=C2SCCC3)c1.[Br-]
|
Cc1cccc(N2CC(O)(c3ccc(Cl)cc3)[N+]3=C2SCCC3)c1.[Br-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.