| Name |
1,3,6-trimethyl-5-((3-(trifluoromethyl)benzyl)thio)pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione
|
| Molecular Formula |
C18H16F3N3O2S
|
| Molecular Weight |
395.4
|
| Smiles |
Cc1cnc2c(c1SCc1cccc(C(F)(F)F)c1)c(=O)n(C)c(=O)n2C
|
Cc1cnc2c(c1SCc1cccc(C(F)(F)F)c1)c(=O)n(C)c(=O)n2C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.