| Name |
N1-(2-ethylbenzofuro[3,2-d]pyrimidin-4-yl)-N4,N4-dimethylbenzene-1,4-diamine
|
| Molecular Formula |
C20H20N4O
|
| Molecular Weight |
332.4
|
| Smiles |
CCc1nc(Nc2ccc(N(C)C)cc2)c2oc3ccccc3c2n1
|
CCc1nc(Nc2ccc(N(C)C)cc2)c2oc3ccccc3c2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.