| Name |
N-(1-Acetyl-2,3-dihydro-1H-indol-5-yl)-3,4-dihydro-3-oxo-2H-1,4-benzoxazine-6-carboxamide
|
| Molecular Formula |
C19H17N3O4
|
| Molecular Weight |
351.4
|
| Smiles |
CC(=O)N1CCc2cc(NC(=O)c3ccc4c(c3)NC(=O)CO4)ccc21
|
CC(=O)N1CCc2cc(NC(=O)c3ccc4c(c3)NC(=O)CO4)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.