| Name |
Ethyl 4-oxo-2-(4-phenylpiperazin-1-yl)-6-(2,3,4-trimethoxyphenyl)-1,4,5,6-tetrahydropyrimidine-5-carboxylate
|
| Molecular Formula |
C26H32N4O6
|
| Molecular Weight |
496.6
|
| Smiles |
CCOC(=O)C1C(=O)NC(N2CCN(c3ccccc3)CC2)=NC1c1ccc(OC)c(OC)c1OC
|
CCOC(=O)C1C(=O)NC(N2CCN(c3ccccc3)CC2)=NC1c1ccc(OC)c(OC)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.