| Name |
7-oxo-2-selanylidene-6H-[1,3]dithiolo[4,5-d]pyrimidin-5-olate;tetrabutylazanium
|
| Molecular Formula |
C21H37N3O2S2Se
|
| Molecular Weight |
506.6
|
| Smiles |
CCCC[N+](CCCC)(CCCC)CCCC.O=c1[nH]c([O-])nc2sc(=[Se])sc12
|
CCCC[N+](CCCC)(CCCC)CCCC.O=c1[nH]c([O-])nc2sc(=[Se])sc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.