| Name |
1h-Isoindole,5-bromo-6-fluoro-2,3-dihydro-2-[(4-methylphenyl)sulfonyl]-
|
| Molecular Formula |
C15H13BrFNO2S
|
| Molecular Weight |
370.2
|
| Smiles |
Cc1ccc(S(=O)(=O)N2Cc3cc(F)c(Br)cc3C2)cc1
|
Cc1ccc(S(=O)(=O)N2Cc3cc(F)c(Br)cc3C2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.