| Name |
4'-(1,3-Dioxolan-2-yl)[1,1'-biphenyl]-4-ol
|
| Molecular Formula |
C15H14O3
|
| Molecular Weight |
242.27
|
| Smiles |
Oc1ccc(-c2ccc(C3OCCO3)cc2)cc1
|
Oc1ccc(-c2ccc(C3OCCO3)cc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.