| Name |
methyl 2-(3,4,9-trimethyl-6,8-dioxo-7-prop-2-enyl-4H-purino[8,7-c][1,2,4]triazin-1-yl)acetate
|
| Molecular Formula |
C16H20N6O4
|
| Molecular Weight |
360.37
|
| Smiles |
C=CCn1c(=O)c2c(nc3n2C(C)C(C)=NN3CC(=O)OC)n(C)c1=O
|
C=CCn1c(=O)c2c(nc3n2C(C)C(C)=NN3CC(=O)OC)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.