| Name |
3-{1-[(4-Chlorophenyl)sulfonyl]piperidin-4-yl}[1,2,4]triazolo[4,3-a]pyridine
|
| Molecular Formula |
C17H17ClN4O2S
|
| Molecular Weight |
376.9
|
| Smiles |
O=S(=O)(c1ccc(Cl)cc1)N1CCC(c2nnc3ccccn23)CC1
|
O=S(=O)(c1ccc(Cl)cc1)N1CCC(c2nnc3ccccn23)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.