| Name |
ethyl 2-(2-((7-chloro-1,1-dioxido-4H-benzo[e][1,2,4]thiadiazin-3-yl)thio)acetamido)acetate
|
| Molecular Formula |
C13H14ClN3O5S2
|
| Molecular Weight |
391.9
|
| Smiles |
CCOC(=O)CNC(=O)CSC1=NS(=O)(=O)c2cc(Cl)ccc2N1
|
CCOC(=O)CNC(=O)CSC1=NS(=O)(=O)c2cc(Cl)ccc2N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.