| Name |
(3S,3aS,5aS,6S,9aS,9bS)-3-(tert-butoxy)-3a,6-dimethyl-7-oxo-dodecahydro-1H-cyclopenta[a]naphthalene-6-carbaldehyde
|
| Molecular Formula |
C20H32O3
|
| Molecular Weight |
320.5
|
| Smiles |
CC(C)(C)OC1CCC2C3CCC(=O)C(C)(C=O)C3CCC12C
|
CC(C)(C)OC1CCC2C3CCC(=O)C(C)(C=O)C3CCC12C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.