| Name |
8,11-Bis(Boc)-1,8,11,18-tetraazaoctadecane
|
| Molecular Formula |
C24H50N4O4
|
| Molecular Weight |
458.7
|
| Smiles |
CC(C)(C)OC(=O)N(CCCCCCN)CCN(CCCCCCN)C(=O)OC(C)(C)C
|
CC(C)(C)OC(=O)N(CCCCCCN)CCN(CCCCCCN)C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.