| Name |
10'-hydroxy-6'-methyl-2',3',9',10'-tetrahydrospiro[cyclohexane-1,8'-cyclopenta[c]pyrano[3,2-g]chromen]-4'(1'H)-one
|
| Molecular Formula |
C21H24O4
|
| Molecular Weight |
340.4
|
| Smiles |
Cc1c2c(cc3c4c(c(=O)oc13)CCC4)C(O)CC1(CCCCC1)O2
|
Cc1c2c(cc3c4c(c(=O)oc13)CCC4)C(O)CC1(CCCCC1)O2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.