| Name |
(2-Chloroethyl)carbamic acid 3-(3-oxo-1,2-benzisothiazol-2(3H)-yl)propyl ester
|
| Molecular Formula |
C13H15ClN2O3S
|
| Molecular Weight |
314.79
|
| Smiles |
O=C(NCCCl)OCCCn1sc2ccccc2c1=O
|
O=C(NCCCl)OCCCn1sc2ccccc2c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.