| Name |
Tricyclo[4.3.1.1,3,8]undec-4-ene-4-carboxylic acid
|
| Molecular Formula |
C12H16O2
|
| Molecular Weight |
192.25
|
| Smiles |
O=C(O)C1=CC2CC3CC(C2)CC1C3
|
O=C(O)C1=CC2CC3CC(C2)CC1C3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.