| Name |
1-Pyrrolidinecarboxylic acid, 2-(iodomethyl)-5-oxo-, 1,1-dimethylethyl ester, (R)-
|
| Molecular Formula |
C10H16INO3
|
| Molecular Weight |
325.14
|
| Smiles |
CC(C)(C)OC(=O)N1C(=O)CCC1CI
|
CC(C)(C)OC(=O)N1C(=O)CCC1CI
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.