| Name |
(1R,2R)-1,2-Bis((S)-2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diol
|
| Molecular Formula |
C12H22O6
|
| Molecular Weight |
262.30
|
| Smiles |
CC1(C)OCC(C(O)C(O)C2COC(C)(C)O2)O1
|
CC1(C)OCC(C(O)C(O)C2COC(C)(C)O2)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.