| Name |
[(5R,6R)-5-hydroxy-11-methoxy-2,7,7-trimethyl-13-oxo-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-6-yl] acetate
|
| Molecular Formula |
C26H25NO6
|
| Molecular Weight |
447.5
|
| Smiles |
COc1cc2c(c3c1c(=O)c1cc4ccccc4cc1n3C)C(O)C(OC(C)=O)C(C)(C)O2
|
COc1cc2c(c3c1c(=O)c1cc4ccccc4cc1n3C)C(O)C(OC(C)=O)C(C)(C)O2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.