| Name |
3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid;(2S,3S,4S,5R)-6-(methylamino)hexane-1,2,3,4,5-pentol
|
| Molecular Formula |
C18H26I3N3O9
|
| Molecular Weight |
809.1
|
| Smiles |
CNC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I.CNCC(O)C(O)C(O)C(O)CO
|
CNC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I.CNCC(O)C(O)C(O)C(O)CO
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.