| Name |
1-(2,4-Dichlorophenyl)-3-(1,1-dimethylethyl)-1H-1,2,4-triazol-5-amine
|
| Molecular Formula |
C12H14Cl2N4
|
| Molecular Weight |
285.17
|
| Smiles |
CC(C)(C)c1nc(N)n(-c2ccc(Cl)cc2Cl)n1
|
CC(C)(C)c1nc(N)n(-c2ccc(Cl)cc2Cl)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.