| Name |
1-(2-methylpropyl)-5-(3-methylthiophen-2-yl)-5,9-dihydrofuro[3',4':5,6]pyrido[2,3-d]pyrimidine-2,4,6(1H,3H,8H)-trione
|
| Molecular Formula |
C18H19N3O4S
|
| Molecular Weight |
373.4
|
| Smiles |
Cc1ccsc1C1C2=C(COC2=O)Nc2c1c(=O)[nH]c(=O)n2CC(C)C
|
Cc1ccsc1C1C2=C(COC2=O)Nc2c1c(=O)[nH]c(=O)n2CC(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.