| Name |
(Z)-N-(4-methoxy-3,7-dimethylbenzo[d]thiazol-2(3H)-ylidene)-2,3-dihydrobenzo[b][1,4]dioxine-2-carboxamide
|
| Molecular Formula |
C19H18N2O4S
|
| Molecular Weight |
370.4
|
| Smiles |
COc1ccc(C)c2sc(=NC(=O)C3COc4ccccc4O3)n(C)c12
|
COc1ccc(C)c2sc(=NC(=O)C3COc4ccccc4O3)n(C)c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.