| Name |
2-((3-(2-methoxyphenyl)-4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-2-yl)thio)-N-((tetrahydrofuran-2-yl)methyl)acetamide
|
| Molecular Formula |
C24H24N4O4S
|
| Molecular Weight |
464.5
|
| Smiles |
COc1ccccc1-n1c(SCC(=O)NCC2CCCO2)nc2c([nH]c3ccccc32)c1=O
|
COc1ccccc1-n1c(SCC(=O)NCC2CCCO2)nc2c([nH]c3ccccc32)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.