| Name |
1-(3,4-dimethylphenyl)-N-(propan-2-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
|
| Molecular Formula |
C16H19N5
|
| Molecular Weight |
281.36
|
| Smiles |
Cc1ccc(-n2ncc3c(NC(C)C)ncnc32)cc1C
|
Cc1ccc(-n2ncc3c(NC(C)C)ncnc32)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.