| Name |
4-fluoro-N-{2-[6-({[(2-methylphenyl)carbamoyl]methyl}sulfanyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl}benzamide
|
| Molecular Formula |
C23H21FN6O2S
|
| Molecular Weight |
464.5
|
| Smiles |
Cc1ccccc1NC(=O)CSc1ccc2nnc(CCNC(=O)c3ccc(F)cc3)n2n1
|
Cc1ccccc1NC(=O)CSc1ccc2nnc(CCNC(=O)c3ccc(F)cc3)n2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.