| Name |
N-[5-(2,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-3,4-dimethylbenzamide
|
| Molecular Formula |
C17H13Cl2N3O2
|
| Molecular Weight |
362.2
|
| Smiles |
Cc1ccc(C(=O)Nc2nnc(-c3cc(Cl)ccc3Cl)o2)cc1C
|
Cc1ccc(C(=O)Nc2nnc(-c3cc(Cl)ccc3Cl)o2)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.