| Name |
N'-cyclopentyl-N-[2-(4-fluorophenyl)-5,5-dioxo-2H,4H,6H-5lambda6-thieno[3,4-c]pyrazol-3-yl]ethanediamide
|
| Molecular Formula |
C18H19FN4O4S
|
| Molecular Weight |
406.4
|
| Smiles |
O=C(Nc1c2c(nn1-c1ccc(F)cc1)CS(=O)(=O)C2)C(=O)NC1CCCC1
|
O=C(Nc1c2c(nn1-c1ccc(F)cc1)CS(=O)(=O)C2)C(=O)NC1CCCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.