| Name |
2,6-Dibromodithieno[3,2-b:2',3'-d]thiophene 4,4-dioxide
|
| Molecular Formula |
C8H2Br2O2S3
|
| Molecular Weight |
386.1
|
| Smiles |
O=S1(=O)c2cc(Br)sc2-c2sc(Br)cc21
|
O=S1(=O)c2cc(Br)sc2-c2sc(Br)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.