| Name |
1-(3,5-Difluorophenyl)dihydro-1,2,4-triazine-3,5(2H,4H)-dione
|
| Molecular Formula |
C9H7F2N3O2
|
| Molecular Weight |
227.17
|
| Smiles |
O=C1CN(c2cc(F)cc(F)c2)NC(=O)N1
|
O=C1CN(c2cc(F)cc(F)c2)NC(=O)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.